ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
| termék neve |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
| Angol név |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile;1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
| MF |
C14H17NO |
| Molekulatömeg |
215.2909 |
| InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| CAS-szám |
36263-51-1 |
| EINECS |
252-938-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.06g/cm3 |
| Olvadáspont |
40-45℃ |
| Forráspont |
362°C at 760 mmHg |
| Törésmutató |
1.538 |
| Gyulladáspont |
152.6°C |
| Gőznyomás |
2E-05mmHg at 25°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
