ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
termék neve |
4-Fluoro-1-iodo-2-nitrobenzene |
Angol név |
4-Fluoro-1-iodo-2-nitrobenzene; 2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene; 1-Fluoro-4-iodo-3-nitrobenzene |
MF |
C6H5FN2O2 |
Molekulatömeg |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
CAS-szám |
364-77-2 |
EINECS |
206-666-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.448g/cm3 |
Forráspont |
295.1°C at 760 mmHg |
Törésmutató |
1.603 |
Gyulladáspont |
89.4°C |
Gőznyomás |
0.00155mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|