3760-11-0 2-Nonenoic acid
termék neve |
2-Nonenoic acid |
Angol név |
2-Nonenoic acid; trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
MF |
C9H16O2 |
Molekulatömeg |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
CAS-szám |
3760-11-0 |
EINECS |
223-171-5 |
Molekuláris szerkezete |
|
Sűrűség |
0.944g/cm3 |
Forráspont |
261.5°C at 760 mmHg |
Törésmutató |
1.46 |
Gyulladáspont |
168.3°C |
Gőznyomás |
0.00341mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|