ChemNet > CAS > 37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
termék neve |
4-Oxo-4-phenylamino-2-butenoic acid |
Angol név |
4-Oxo-4-phenylamino-2-butenoic acid;4-Oxo-4-(phenylamino)-2-butenoic acid; 4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoate |
MF |
C10H8NO3 |
Molekulatömeg |
190.176 |
InChI |
InChI=1/C10H9NO3/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8/h1-7H,(H,11,12)(H,13,14)/p-1/b7-6+ |
CAS-szám |
37902-58-2 |
EINECS |
253-707-3 |
Molekuláris szerkezete |
|
Forráspont |
442.1°C at 760 mmHg |
Gyulladáspont |
221.1°C |
Gőznyomás |
1.36E-08mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|