394-35-4 methyl 2-fluorobenzoate
termék neve |
methyl 2-fluorobenzoate |
Angol név |
methyl 2-fluorobenzoate; 2-Fluorobenzoic acid methyl ester |
MF |
C8H7FO2 |
Molekulatömeg |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS-szám |
394-35-4 |
EINECS |
206-894-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.21 |
Forráspont |
99℃ (18 torr) |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|