39635-11-5 3,4-Dihydroxybenzhydrazide

termék neve	3,4-Dihydroxybenzhydrazide
Angol név	3,4-Dihydroxybenzhydrazide; 3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide
MF	C₇H₈N₂O₃
Molekulatömeg	168.15
InChI	InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12)
CAS-szám	39635-11-5
EINECS	254-550-3
Molekuláris szerkezete
Sűrűség	1.477g/cm³
Törésmutató	1.67
Veszély szimbólumok
Kockázatot kódok	R36/37/38:Irritating to eyes, respiratory system and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;