ChemNet > CAS > 3964-58-7 3-Chloro-4-hydroxybenzoic acid hemihydrate
3964-58-7 3-Chloro-4-hydroxybenzoic acid hemihydrate
termék neve |
3-Chloro-4-hydroxybenzoic acid hemihydrate |
Angol név |
3-Chloro-4-hydroxybenzoic acid hemihydrate; 3-Chloro-4-hydroxybenzoic acid; 3-chloro-4-hydroxybenzoic acid hydrate; 3-chloro-4-hydroxybenzoate |
MF |
C7H4ClO3 |
Molekulatömeg |
171.5584 |
InChI |
InChI=1/C7H5ClO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11)/p-1 |
CAS-szám |
3964-58-7 |
EINECS |
223-574-6 |
Molekuláris szerkezete |
|
Olvadáspont |
168-172℃ |
Forráspont |
330.5°C at 760 mmHg |
Gyulladáspont |
153.7°C |
Gőznyomás |
6.65E-05mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|