ChemNet > CAS > 39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
termék neve |
5-Methoxy-1-methylindole-3-carboxaldehyde |
Angol név |
5-Methoxy-1-methylindole-3-carboxaldehyde; 3-Formyl-5-methoxy-1-methylindole; 5-methoxy-1-methyl-1H-indole-3-carbaldehyde |
MF |
C11H11NO2 |
Molekulatömeg |
189.2105 |
InChI |
InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3 |
CAS-szám |
39974-94-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.14g/cm3 |
Forráspont |
357.9°C at 760 mmHg |
Törésmutató |
1.565 |
Gyulladáspont |
170.2°C |
Gőznyomás |
2.65E-05mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|