4079-52-1 2-Methoxyacetophenone
termék neve |
2-Methoxyacetophenone |
Angol név |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
MF |
C9H10O2 |
Molekulatömeg |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
CAS-szám |
4079-52-1 |
EINECS |
223-802-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.035g/cm3 |
Olvadáspont |
7-8℃ |
Forráspont |
245°C at 760 mmHg |
Törésmutató |
1.504 |
Gyulladáspont |
92.8°C |
Gőznyomás |
0.0294mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|