ChemNet > CAS > 4144-62-1 5-Benzoylpentanoic acid
4144-62-1 5-Benzoylpentanoic acid
termék neve |
5-Benzoylpentanoic acid |
Angol név |
5-Benzoylpentanoic acid; 6-Oxo-6-phenylhexanoic acid |
MF |
C12H14O3 |
Molekulatömeg |
206.2378 |
InChI |
InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
CAS-szám |
4144-62-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.135g/cm3 |
Forráspont |
385.3°C at 760 mmHg |
Törésmutató |
1.533 |
Gyulladáspont |
201°C |
Gőznyomás |
1.26E-06mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|