ChemNet > CAS > 41513-32-0 transz-1,4-ciklohexéndiol
41513-32-0 transz-1,4-ciklohexéndiol
| termék neve |
transz-1,4-ciklohexéndiol |
| Szinonimák |
(1S,4S)-ciklohex-2-én-1,4-diol; (1R,4S)-ciklohex-2-én-1,4-diol; (1R,4R)-ciklohex-2-én-1,4-diol |
| Angol név |
trans-1,4-Cyclohexenediol;(1S,4S)-cyclohex-2-ene-1,4-diol; (1R,4S)-cyclohex-2-ene-1,4-diol; (1R,4R)-cyclohex-2-ene-1,4-diol |
| MF |
C6H10O2 |
| Molekulatömeg |
114.1424 |
| InChI |
InChI=1/C6H10O2/c7-5-1-2-6(8)4-3-5/h1-2,5-8H,3-4H2/t5-,6-/m0/s1 |
| CAS-szám |
41513-32-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.217g/cm3 |
| Olvadáspont |
84-87℃ |
| Forráspont |
242.8°C at 760 mmHg |
| Törésmutató |
1.563 |
| Gyulladáspont |
119.3°C |
| Gőznyomás |
0.00565mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
