ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
termék neve |
2-Formylthiophene-3-boronic acid |
Angol név |
2-Formylthiophene-3-boronic acid; 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
MF |
C5H5BO3S |
Molekulatömeg |
155.9674 |
InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
CAS-szám |
4347-31-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.41g/cm3 |
Olvadáspont |
167-173℃ |
Forráspont |
396.7°C at 760 mmHg |
Törésmutató |
1.573 |
Gyulladáspont |
193.7°C |
Gőznyomás |
5.27E-07mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|