ChemNet > CAS > 458-05-9 1-(3-fluorophenyl)-2-thiourea
458-05-9 1-(3-fluorophenyl)-2-thiourea
termék neve |
1-(3-fluorophenyl)-2-thiourea |
Angol név |
1-(3-fluorophenyl)-2-thiourea; 3-Fluorophenylthiourea; 1-(3-fluorophenyl)thiourea |
MF |
C7H7FN2S |
Molekulatömeg |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-szám |
458-05-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.397g/cm3 |
Forráspont |
259.3°C at 760 mmHg |
Törésmutató |
1.692 |
Gyulladáspont |
110.6°C |
Gőznyomás |
0.0131mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R25:Toxic if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|