ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
termék neve |
2-aminothiophene-3-carbonitrile |
Angol név |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
MF |
C5H4N2S |
Molekulatömeg |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
CAS-szám |
4651-82-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.33g/cm3 |
Olvadáspont |
104℃ |
Forráspont |
317.5°C at 760 mmHg |
Törésmutató |
1.627 |
Gyulladáspont |
145.8°C |
Gőznyomás |
0.000384mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|