ChemNet > CAS > 4651-97-2 2-amino-4-methylthiophene-3-carboxamide
4651-97-2 2-amino-4-methylthiophene-3-carboxamide
termék neve |
2-amino-4-methylthiophene-3-carboxamide |
Angol név |
2-amino-4-methylthiophene-3-carboxamide; |
MF |
C6H8N2OS |
Molekulatömeg |
156.2055 |
InChI |
InChI=1/C6H8N2OS/c1-3-2-10-6(8)4(3)5(7)9/h2H,8H2,1H3,(H2,7,9) |
CAS-szám |
4651-97-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.344g/cm3 |
Olvadáspont |
173℃ |
Forráspont |
277.1°C at 760 mmHg |
Törésmutató |
1.654 |
Gyulladáspont |
121.4°C |
Gőznyomás |
0.00462mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|