ChemNet > CAS > 505-54-4 Hexadecanedioic acid
505-54-4 Hexadecanedioic acid
termék neve |
Hexadecanedioic acid |
Angol név |
Hexadecanedioic acid; Thapsic acid; 1,16-Hexadecanedioic acid; Hexadecane Diacid; hexadecanedioate |
MF |
C16H28O4 |
Molekulatömeg |
284.3922 |
InChI |
InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
CAS-szám |
505-54-4 |
EINECS |
208-013-5 |
Molekuláris szerkezete |
|
Olvadáspont |
120-123℃ |
Forráspont |
457.5°C at 760 mmHg |
Gyulladáspont |
244.6°C |
Gőznyomás |
1.22E-09mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|