51605-97-1 4-Amino-2-bromocumene
termék neve |
4-Amino-2-bromocumene |
Angol név |
4-Amino-2-bromocumene; 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
MF |
C9H12BrN |
Molekulatömeg |
214.1023 |
InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
CAS-szám |
51605-97-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.355g/cm3 |
Forráspont |
271.8°C at 760 mmHg |
Törésmutató |
1.577 |
Gyulladáspont |
118.2°C |
Gőznyomás |
0.00631mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|