5211-62-1 2-Methoxyphenylacetone
termék neve |
2-Methoxyphenylacetone |
Angol név |
2-Methoxyphenylacetone; 2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
MF |
C10H12O2 |
Molekulatömeg |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
CAS-szám |
5211-62-1 |
EINECS |
226-008-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.027g/cm3 |
Olvadáspont |
127-130℃ (10 mmHg) |
Forráspont |
261.7°C at 760 mmHg |
Törésmutató |
1.501 |
Gyulladáspont |
94°C |
Gőznyomás |
0.0114mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|