ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
termék neve |
3-Ethoxy-2-cyclohexen-1-one |
Angol név |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
MF |
C8H12O2 |
Molekulatömeg |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
CAS-szám |
5323-87-5 |
EINECS |
226-190-7 |
Molekuláris szerkezete |
|
Sűrűség |
1g/cm3 |
Forráspont |
250.1°C at 760 mmHg |
Törésmutató |
1.467 |
Gyulladáspont |
107.2°C |
Gőznyomás |
0.022mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|