5391-30-0 2-Bromophenylthiourea
termék neve |
2-Bromophenylthiourea |
Angol név |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
MF |
C7H7BrN2S |
Molekulatömeg |
231.1129 |
InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-szám |
5391-30-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.728g/cm3 |
Forráspont |
314.2°C at 760 mmHg |
Törésmutató |
1.748 |
Gyulladáspont |
143.8°C |
Gőznyomás |
0.000474mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R25:Toxic if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|