ChemNet > CAS > 5398-27-6 2,6-Diiodo-4-nitroaniline
5398-27-6 2,6-Diiodo-4-nitroaniline
| termék neve |
2,6-Diiodo-4-nitroaniline |
| Angol név |
2,6-Diiodo-4-nitroaniline; 1-(3-methylphenyl)-2,3,4,9-tetrahydro-1H-beta-carboline |
| MF |
C18H18N2 |
| Molekulatömeg |
262.3489 |
| InChI |
InChI=1/C18H18N2/c1-12-5-4-6-13(11-12)17-18-15(9-10-19-17)14-7-2-3-8-16(14)20-18/h2-8,11,17,19-20H,9-10H2,1H3 |
| CAS-szám |
5398-27-6 |
| EINECS |
226-429-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.165g/cm3 |
| Olvadáspont |
251-256℃ |
| Forráspont |
455.4°C at 760 mmHg |
| Törésmutató |
1.661 |
| Gyulladáspont |
229.2°C |
| Gőznyomás |
1.77E-08mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
