ChemNet > CAS > 34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
| termék neve |
2,5-Dichlorobenzyl alcohol |
| Angol név |
2,5-Dichlorobenzyl alcohol; 2,5-Dichlorobenzylic alcohol; (2,5-dichlorophenyl)methanol |
| MF |
C7H6Cl2O |
| Molekulatömeg |
177.0279 |
| InChI |
InChI=1/C7H6Cl2O/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2 |
| CAS-szám |
34145-05-6;5402-73-7 |
| EINECS |
251-850-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.392g/cm3 |
| Olvadáspont |
77-80℃ |
| Forráspont |
265.7°C at 760 mmHg |
| Törésmutató |
1.582 |
| Gyulladáspont |
114.3°C |
| Gőznyomás |
0.00452mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
