ChemNet > CAS > 5413-05-8 Ethyl 2-phenylacetoacetate
5413-05-8 Ethyl 2-phenylacetoacetate
termék neve |
Ethyl 2-phenylacetoacetate |
Angol név |
Ethyl 2-phenylacetoacetate; 2-Phenylacetoacetic acid ethyl ester; ethyl 3-oxo-2-phenylbutanoate; ethyl (2S)-3-oxo-2-phenylbutanoate |
MF |
C12H14O3 |
Molekulatömeg |
206.2378 |
InChI |
InChI=1/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3/t11-/m1/s1 |
CAS-szám |
5413-05-8 |
EINECS |
226-500-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.087g/cm3 |
Forráspont |
281.6°C at 760 mmHg |
Törésmutató |
1.503 |
Gyulladáspont |
119.2°C |
Gőznyomás |
0.00354mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|