543-20-4 Succinyl chloride
termék neve |
Succinyl chloride |
Angol név |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
MF |
C4H4Cl2O2 |
Molekulatömeg |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
CAS-szám |
543-20-4 |
EINECS |
208-838-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.389g/cm3 |
Olvadáspont |
16-17℃ |
Forráspont |
193.4°C at 760 mmHg |
Törésmutató |
1.456 |
Gyulladáspont |
76.7°C |
Gőznyomás |
0.466mmHg at 25°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|