ChemNet > CAS > 54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
| termék neve |
4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole |
| Angol név |
4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole;4-(chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole |
| MF |
C8H6ClNS2 |
| Molekulatömeg |
215.7229 |
| InChI |
InChI=1/C8H6ClNS2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4H2 |
| CAS-szám |
54679-16-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.395g/cm3 |
| Olvadáspont |
51℃ |
| Forráspont |
362°C at 760 mmHg |
| Törésmutató |
1.636 |
| Gyulladáspont |
172.7°C |
| Gőznyomás |
4.15E-05mmHg at 25°C |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
