ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
termék neve |
p-Diethylaminoacetophenone |
Angol név |
p-Diethylaminoacetophenone; 4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
MF |
C12H17NO |
Molekulatömeg |
191.2695 |
InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
CAS-szám |
5520-66-1 |
Molekuláris szerkezete |
|
Sűrűség |
0.996g/cm3 |
Forráspont |
313.9°C at 760 mmHg |
Törésmutató |
1.536 |
Gyulladáspont |
114.4°C |
Gőznyomás |
0.000482mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|