ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
termék neve |
bis(2-methoxyphenyl) carbonate |
Angol név |
bis(2-methoxyphenyl) carbonate; diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
MF |
C15H14O5 |
Molekulatömeg |
274.2687 |
InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
CAS-szám |
553-17-3 |
EINECS |
209-034-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.208g/cm3 |
Forráspont |
392.6°C at 760 mmHg |
Törésmutató |
1.552 |
Gyulladáspont |
173.7°C |
Gőznyomás |
2.27E-06mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|