ChemNet > CAS > 55751-54-7 2-sec-butylaniline
55751-54-7 2-sec-butylaniline
| termék neve |
2-sec-butylaniline |
| Angol név |
2-sec-butylaniline; Benzenamine, 2-(1-methylpropyl)-; 2-sec-Butylaniline; 2-(butan-2-yl)aniline; 2-(sec-Butyl)aniline |
| MF |
C10H15N |
| Molekulatömeg |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8H,3,11H2,1-2H3 |
| CAS-szám |
55751-54-7 |
| EINECS |
259-794-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
0.942g/cm3 |
| Forráspont |
239°C at 760 mmHg |
| Törésmutató |
1.535 |
| Gyulladáspont |
101.5°C |
| Gőznyomás |
0.0412mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
