ChemNet > CAS > 5585-33-1 2-(4-Morpholino)aniline
5585-33-1 2-(4-Morpholino)aniline
| termék neve |
2-(4-Morpholino)aniline |
| Angol név |
2-(4-Morpholino)aniline; 4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
| MF |
C10H14N2O |
| Molekulatömeg |
178.231 |
| InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
| CAS-szám |
5585-33-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.149g/cm3 |
| Olvadáspont |
93℃ |
| Forráspont |
332.5°C at 760 mmHg |
| Törésmutató |
1.589 |
| Gyulladáspont |
154.9°C |
| Gőznyomás |
0.000146mmHg at 25°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
