ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
termék neve |
1,5-Dimethyl-2-pyrrolecarbonitrile |
Angol név |
1,5-Dimethyl-2-pyrrolecarbonitrile; 1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
MF |
C7H8N2 |
Molekulatömeg |
120.1518 |
InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
CAS-szám |
56341-36-7 |
EINECS |
260-120-6 |
Molekuláris szerkezete |
|
Sűrűség |
0.98g/cm3 |
Olvadáspont |
53-56℃ |
Forráspont |
238.9°C at 760 mmHg |
Törésmutató |
1.529 |
Gyulladáspont |
104.4°C |
Gőznyomás |
0.0414mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21:Harmful by inhalation and in contact with skin.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|