570-08-1 Diethyl acetylmalonate

termék neve	Diethyl acetylmalonate
Angol név	Diethyl acetylmalonate; Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate
MF	C₉H₁₂O₅
Molekulatömeg	200.1897
InChI	InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2
CAS-szám	570-08-1
Molekuláris szerkezete
Forráspont	372.3°C at 760 mmHg
Gyulladáspont	193.1°C
Gőznyomás	1.45E-06mmHg at 25°C
Veszély szimbólumok
Kockázatot kódok	R36/38:Irritating to eyes and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;