termék neve |
teofillin-2-aminoetanol |
Szinonimák |
Teofillin-olamin; Teofillin etanol-amin; Clysmathane; Etanol, 2-amino-, compd.teofillinnel (1:1); Fleet-teofillin; monoteamin; monoteamin; monoxantil; teamin; Teofillin vegyület 2-aminoetanollal (1:1); Teofillin-monoetanol-amin; Teopilin-monoetanol-amin; Unophyllin; 1H-purin-2,6-dion, 3,7-dihidro-1,3-dimetil-, compd.2-aminoetanollal (1:1); Teofillin 2-aminoetanol; Teofillin, 2-aminoetanollal (1:1); 1,3-dimetil-3,7-dihidro-1H-purin-2,6-dion-2-aminoetanol (1:1) |
Angol név |
theophylline--2-aminoethanol;Theophylline olamine; Theophylline ethanolamine; Clysmathane; Ethanol, 2-amino-, compd. with theophylline (1:1); Fleet-theophylline; Monotheamin; Monotheamine; Monoxantil; Theamin; Theophylline compound with 2-aminoethanol (1:1); Theophylline monoethanolamine; Theopylline monoethanolamine; Unophyllin; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd. with 2-aminoethanol (1:1); Theophylline 2-aminoethanol; Theophylline, compd. with 2-aminoethanol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-aminoethanol (1:1) |
MF |
C9H15N5O3 |
Molekulatömeg |
241.2471 |
InChI |
InChI=1/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
CAS-szám |
573-41-1 |
EINECS |
209-355-8 |
Molekuláris szerkezete |
|
Forráspont |
454.1°C at 760 mmHg |
Gyulladáspont |
228.4°C |
Gőznyomás |
1.96E-08mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
|
|