ChemNet > CAS > 5785-66-0 Cyclopropyl diphenyl carbinol
5785-66-0 Cyclopropyl diphenyl carbinol
| termék neve |
Cyclopropyl diphenyl carbinol |
| Angol név |
Cyclopropyl diphenyl carbinol; alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
| MF |
C12H14N4O |
| Molekulatömeg |
230.2658 |
| InChI |
InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
| CAS-szám |
5785-66-0 |
| EINECS |
227-312-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.16g/cm3 |
| Olvadáspont |
82-85℃ |
| Forráspont |
419°C at 760 mmHg |
| Törésmutató |
1.59 |
| Gyulladáspont |
207.2°C |
| Gőznyomás |
3.13E-07mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
