588-43-2 tributyl orthoformate
termék neve |
tributyl orthoformate |
Angol név |
tributyl orthoformate; 1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
MF |
C13H28O3 |
Molekulatömeg |
232.3596 |
InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
CAS-szám |
588-43-2 |
EINECS |
209-618-7 |
Molekuláris szerkezete |
|
Sűrűség |
0.884g/cm3 |
Forráspont |
262.7°C at 760 mmHg |
Törésmutató |
1.427 |
Gyulladáspont |
96.3°C |
Gőznyomás |
0.0175mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|