589-62-8 4-octanol
termék neve |
4-octanol |
Angol név |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
MF |
C8H18O |
Molekulatömeg |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
CAS-szám |
589-62-8 |
EINECS |
209-654-3 |
Molekuláris szerkezete |
|
Sűrűség |
0.821g/cm3 |
Forráspont |
179.2°C at 760 mmHg |
Törésmutató |
1.426 |
Gyulladáspont |
71.1°C |
Gőznyomás |
0.284mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|