591-08-2 N-Acetylthiourea
termék neve |
N-Acetylthiourea |
Angol név |
N-Acetylthiourea; N-Acetylthiourea,98%; N-carbamothioylacetamide |
MF |
C3H6N2OS |
Molekulatömeg |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
CAS-szám |
591-08-2 |
EINECS |
209-699-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.275g/cm3 |
Olvadáspont |
166-168℃ |
Forráspont |
208.6°C at 760 mmHg |
Törésmutató |
1.569 |
Gyulladáspont |
80°C |
Gőznyomás |
0.212mmHg at 25°C |
Veszély szimbólumok |
T:Toxic;
|
Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|