593-96-4 1-Bromo-1-chloroethane
termék neve |
1-Bromo-1-chloroethane |
Angol név |
1-Bromo-1-chloroethane;Ethane, 1-bromo-1-chloro- |
MF |
C2H4BrCl |
Molekulatömeg |
143.4102 |
InChI |
InChI=1/C2H4BrCl/c1-2(3)4/h2H,1H3 |
CAS-szám |
593-96-4 |
EINECS |
209-820-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.658g/cm3 |
Forráspont |
79.5°C at 760 mmHg |
Törésmutató |
1.463 |
Gőznyomás |
98.1mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|