| termék neve |
alfa-D-glükoheptonsav gamma-lakton |
| Szinonimák |
; alfa-D-glükoheptonikus gamma-lakton; (4S,5S)-3,4-dihidroxi-5-[(1R,2R)-1,2,3-trihidroxipropil]dihidrofurán-2(3H)-on (nem preferált név); (3R,4S,5S)-3,4-dihidroxi-5-[(1R,2R)-1,2,3-trihidroxipropil]dihidrofurán-2(3H)-on (nem preferált név) |
| Angol név |
Alpha-D-Glucoheptonic acid Gamma-lactone; alpha-D-Glucoheptonic gamma-lactone; (4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]dihydrofuran-2(3H)-one (non-preferred name); (3R,4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]dihydrofuran-2(3H)-one (non-preferred name) |
| MF |
C7H12O7 |
| Molekulatömeg |
208.166 |
| InChI |
InChI=1/C7H12O7/c8-1-2(9)3(10)6-4(11)5(12)7(13)14-6/h2-6,8-12H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| CAS-szám |
60046-25-5 |
| EINECS |
262-037-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.806g/cm3 |
| Olvadáspont |
152-155℃ |
| Forráspont |
557.5°C at 760 mmHg |
| Törésmutató |
1.645 |
| Gyulladáspont |
232.1°C |
| Gőznyomás |
9.41E-15mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|