ChemNet > CAS > 60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
termék neve |
3,4-Dimethoxyphenylacetic acid hydrazide |
Angol név |
3,4-Dimethoxyphenylacetic acid hydrazide; 3,4-Dimethoxyphenylacethydrazide~Homoveratric acid hydrazide; 2-(3,4-dimethoxyphenyl)acetohydrazide |
MF |
C10H14N2O3 |
Molekulatömeg |
210.2298 |
InChI |
InChI=1/C10H14N2O3/c1-14-8-4-3-7(5-9(8)15-2)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
CAS-szám |
60075-23-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.168g/cm3 |
Forráspont |
420.3°C at 760 mmHg |
Törésmutató |
1.538 |
Gyulladáspont |
208°C |
Gőznyomás |
2.84E-07mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|