605-62-9 4-Nitro-1-Naphthol
termék neve |
4-Nitro-1-Naphthol |
Angol név |
4-Nitro-1-Naphthol; 4-nitronaphthalen-1-ol |
MF |
C10H7NO3 |
Molekulatömeg |
189.1675 |
InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
CAS-szám |
605-62-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.413g/cm3 |
Forráspont |
398.8°C at 760 mmHg |
Törésmutató |
1.714 |
Gyulladáspont |
179.8°C |
Gőznyomás |
6.25E-07mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|