ChemNet > CAS > 622-20-8 1,2-Bis(phenylthio)ethane
622-20-8 1,2-Bis(phenylthio)ethane
termék neve |
1,2-Bis(phenylthio)ethane |
Angol név |
1,2-Bis(phenylthio)ethane; 1,2-Bis(phenylthio)ethane,98%; 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
MF |
C14H14S2 |
Molekulatömeg |
246.391 |
InChI |
InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
CAS-szám |
622-20-8 |
EINECS |
210-723-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.16g/cm3 |
Forráspont |
377.3°C at 760 mmHg |
Törésmutató |
1.646 |
Gyulladáspont |
184.6°C |
Gőznyomás |
1.48E-05mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|