623-82-5 (+)-3-Methyladipic acid
termék neve |
(+)-3-Methyladipic acid |
Angol név |
(+)-3-Methyladipic acid; Methylhexanedioic acid; (3R)-3-methylhexanedioic acid; (3R)-3-methylhexanedioate |
MF |
C7H10O4 |
Molekulatömeg |
158.153 |
InChI |
InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m1/s1 |
CAS-szám |
623-82-5 |
EINECS |
210-816-0 |
Molekuláris szerkezete |
|
Olvadáspont |
81-84℃ |
Forráspont |
341.4°C at 760 mmHg |
Gyulladáspont |
170.6°C |
Gőznyomás |
1.47E-05mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|