6267-24-9 Tris(ethylthio)methane
termék neve |
Tris(ethylthio)methane |
Angol név |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
MF |
C7H16S3 |
Molekulatömeg |
196.3969 |
InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
CAS-szám |
6267-24-9 |
EINECS |
228-439-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.053g/cm3 |
Forráspont |
269.2°C at 760 mmHg |
Törésmutató |
1.539 |
Gyulladáspont |
111.3°C |
Gőznyomás |
0.0122mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|