ChemNet > CAS > 627-04-3 (Ethylthio)acetic acid
627-04-3 (Ethylthio)acetic acid
| termék neve |
(Ethylthio)acetic acid |
| Angol név |
(Ethylthio)acetic acid; S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
| MF |
C4H8O2S |
| Molekulatömeg |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
| CAS-szám |
627-04-3 |
| EINECS |
210-979-8 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.164g/cm3 |
| Forráspont |
229°C at 760 mmHg |
| Törésmutató |
1.496 |
| Gyulladáspont |
92.3°C |
| Gőznyomás |
0.0254mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
