6304-16-1 (4-Pyridyl)acetone
termék neve |
(4-Pyridyl)acetone |
Angol név |
(4-Pyridyl)acetone; 1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
MF |
C8H9NO |
Molekulatömeg |
135.1632 |
InChI |
InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
CAS-szám |
6304-16-1 |
EINECS |
228-605-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.047g/cm3 |
Forráspont |
232.523°C at 760 mmHg |
Törésmutató |
1.509 |
Gyulladáspont |
100.06°C |
Gőznyomás |
0.059mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|