ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
| termék neve |
4-Ethylphenylboronic acid |
| Angol név |
4-Ethylphenylboronic acid; 4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
| MF |
C8H11BO2 |
| Molekulatömeg |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS-szám |
63139-21-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.07g/cm3 |
| Olvadáspont |
150-155℃ |
| Forráspont |
285.1°C at 760 mmHg |
| Törésmutató |
1.521 |
| Gyulladáspont |
126.2°C |
| Gőznyomás |
0.00134mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
