ChemNet > CAS > 6320-40-7 2,4,6-Tribromotoluene
6320-40-7 2,4,6-Tribromotoluene
termék neve |
2,4,6-Tribromotoluene |
Angol név |
2,4,6-Tribromotoluene;1,3,5-tribromo-2-methylbenzene |
MF |
C7H5Br3 |
Molekulatömeg |
328.8266 |
InChI |
InChI=1/C7H5Br3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 |
CAS-szám |
6320-40-7 |
EINECS |
228-672-2 |
Molekuláris szerkezete |
|
Sűrűség |
2.131g/cm3 |
Forráspont |
290.7°C at 760 mmHg |
Törésmutató |
1.619 |
Gyulladáspont |
127.6°C |
Gőznyomás |
0.00356mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|