ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
termék neve |
Bis(carboxymethyl) trithiocarbonate |
Angol név |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
MF |
C5H4O4S3 |
Molekulatömeg |
224.279 |
InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
CAS-szám |
6326-83-6 |
EINECS |
228-693-7 |
Molekuláris szerkezete |
|
Olvadáspont |
170-175℃ |
Forráspont |
532.5°C at 760 mmHg |
Gyulladáspont |
275.9°C |
Gőznyomás |
9.26E-13mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|