ChemNet > CAS > 6373-50-8 4-Cyclohexylaniline
6373-50-8 4-Cyclohexylaniline
termék neve |
4-Cyclohexylaniline |
Angol név |
4-Cyclohexylaniline;1-(2,4-dichlorophenyl)-3-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]urea |
MF |
C16H12Cl2N4OS |
Molekulatömeg |
379.2637 |
InChI |
InChI=1/C16H12Cl2N4OS/c1-9-2-4-10(5-3-9)14-21-22-16(24-14)20-15(23)19-13-7-6-11(17)8-12(13)18/h2-8H,1H3,(H2,19,20,22,23) |
CAS-szám |
6373-50-8 |
EINECS |
228-918-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.509g/cm3 |
Törésmutató |
1.716 |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|