638-32-4 Succinamic acid
termék neve |
Succinamic acid |
Angol név |
Succinamic acid; Butanedioic acid monoamide; 4-amino-4-oxobutanoic acid; 4-amino-4-oxobutanoate |
MF |
C4H6NO3 |
Molekulatömeg |
116.0959 |
InChI |
InChI=1/C4H7NO3/c5-3(6)1-2-4(7)8/h1-2H2,(H2,5,6)(H,7,8)/p-1 |
CAS-szám |
638-32-4 |
EINECS |
211-331-7 |
Molekuláris szerkezete |
|
Olvadáspont |
153-157℃ |
Forráspont |
421.3°C at 760 mmHg |
Gyulladáspont |
208.6°C |
Gőznyomás |
2.8E-08mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|